PRODUCTS
Triacetin (Industrial Grade)
| CAS NO. | 102-76-1 |
| EINECS No. | 203-051-9 |
| Synonyms | Glycerol Triacetate, 1,2,3 Propanetriol Triacetate, Triacetyl Glycerine, Vanay |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.21 |
| Constitutional Formula | CH3COOCH2CH(CH3COO)CH2(CH3COO) |
| Applications | 1. Used as core sand binder in metal foundry sector. 2. Used as solvent in printing inks. 3. Used as a highly effective plasticizer for cellulose-based plastics. 4. Used as solvent in building wall coating |
Specification:
| Item | Unit | Standard | Test Method |
| Appearance | Clear liquid, free from suspended matter | Visual | |
| Odour | Smellless | Smelling | |
| Triacetin Content | ％ | ≥98.5 | GC |
| Colour | Hazen | ≤30 | GB/T3143-1982 |
| Refraction Index (20℃) | -- | 1.430～1.435 | GB/T6488-2008 |
| Specific Gravity（20℃） | g/ml | 1.154～1.164 | GB/T4472-1984 |
| Water | % | ≤0.2 | GB/T6283-2008 |
| Acidity (as HAC) | % | ≤0.1 | GB/T12717 |
| Packing | New 200 Litre steel drum containing 240kg net. New 1000 Litre IBC containing 1150kg net. Isotank containing 20,000kg~25,000kg net. |
| Storage | Keep in sealed, unopened, original containers. Avoid conditions of high humidity and temperature. |
| Storage Temperature | 10℃-30 ℃ |
| Shelf Life | 12 months |
